Having problems with message search?
Why the cleanup chemical of EVOS (2-butoxyethanol) should be suspect for 'gulf war syndrome'
http://www.valdezlink.com/gwv/reply-texas-allocation.htm
and many other health concerns showing up in Valdez people who were in Valdez in 1989
My testimony to the EVOS Trustee Council 3-6-06
http://www.valdezlink.com/evos/trusteecouncil.htm
Next time - Don't let Exxon run the show
http://www.valdezlink.com/inipol/pages/run.htm
Also significant concerns for FLU, diabetes, obesity, & many other autoimmune metabolic issues
|
2-butoxyethanol C6H14O2/CH3(CH2)2CH2OCH2CH2OH CAS No: 111-76-2 is a neurotoxin, pesticide, poison, solvent & a teratogen |
|
Why don't we look in that direction? |
Where is Corexit in the Military?
Offline 
Send Email